C24H22N4Pt — CID 58401857
bis(3-methyl-5,9-dihydro-4H-benzo[e]benzimidazol-9-ide);platinum(2+) (PubChem CID 58401857) has the molecular formula C24H22N4Pt and a molecular weight of 561.55 g/mol. Its IUPAC name is bis(3-methyl-5,9-dihydro-4H-benzo[e]benzimidazol-9-ide);platinum(2+).
| Compound Name | bis(3-methyl-5,9-dihydro-4H-benzo[e]benzimidazol-9-ide);platinum(2+) |
|---|---|
| PubChem CID | 58401857 |
| Molecular Formula | C24H22N4Pt |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | bis(3-methyl-5,9-dihydro-4H-benzo[e]benzimidazol-9-ide);platinum(2+) |
| SMILES | Cn1cnc2c1CCc1ccc[c-]c1-2.Cn1cnc2c1CCc1ccc[c-]c1-2.[Pt+2] |
| InChI | InChI=1S/2C12H11N2.Pt/c2*1-14-8-13-12-10-5-3-2-4-9(10)6-7-11(12)14;/h2*2-4,8H,6-7H2,1H3;/q2*-1;+2 |
| InChIKey | UPZOFYSFCCJLLB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|