C20H20N6Pt — CID 58401802
bis(3-(1,5-dimethylimidazol-4-yl)-4H-pyridin-4-ide);platinum(2+) (PubChem CID 58401802) has the molecular formula C20H20N6Pt and a molecular weight of 539.50 g/mol. Its IUPAC name is bis(3-(1,5-dimethylimidazol-4-yl)-4H-pyridin-4-ide);platinum(2+).
| Compound Name | bis(3-(1,5-dimethylimidazol-4-yl)-4H-pyridin-4-ide);platinum(2+) |
|---|---|
| PubChem CID | 58401802 |
| Molecular Formula | C20H20N6Pt |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | bis(3-(1,5-dimethylimidazol-4-yl)-4H-pyridin-4-ide);platinum(2+) |
| SMILES | Cc1c(-c2[c-]ccnc2)ncn1C.Cc1c(-c2[c-]ccnc2)ncn1C.[Pt+2] |
| InChI | InChI=1S/2C10H10N3.Pt/c2*1-8-10(12-7-13(8)2)9-4-3-5-11-6-9;/h2*3,5-7H,1-2H3;/q2*-1;+2 |
| InChIKey | RGPZUKFYPBTDMD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|