C23H26N5Pt+ — CID 59661517
1,5-dimethyl-4-(2-methylbenzene-6-id-1-yl)imidazole;4,5-dimethyl-1-(2-methylbenzene-6-id-1-yl)-1,2,4-triazol-4-ium;platinum(2+) (PubChem CID 59661517) has the molecular formula C23H26N5Pt+ and a molecular weight of 567.57 g/mol. Its IUPAC name is 1,5-dimethyl-4-(2-methylbenzene-6-id-1-yl)imidazole;4,5-dimethyl-1-(2-methylbenzene-6-id-1-yl)-1,2,4-triazol-4-ium;platinum(2+).
| Compound Name | 1,5-dimethyl-4-(2-methylbenzene-6-id-1-yl)imidazole;4,5-dimethyl-1-(2-methylbenzene-6-id-1-yl)-1,2,4-triazol-4-ium;platinum(2+) |
|---|---|
| PubChem CID | 59661517 |
| Molecular Formula | C23H26N5Pt+ |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 1,5-dimethyl-4-(2-methylbenzene-6-id-1-yl)imidazole;4,5-dimethyl-1-(2-methylbenzene-6-id-1-yl)-1,2,4-triazol-4-ium;platinum(2+) |
| SMILES | Cc1ccc[c-]c1-c1ncn(C)c1C.Cc1ccc[c-]c1-n1nc[n+](C)c1C.[Pt+2] |
| InChI | InChI=1S/C12H13N2.C11H13N3.Pt/c1-9-6-4-5-7-11(9)12-10(2)14(3)8-13-12;1-9-6-4-5-7-11(9)14-10(2)13(3)8-12-14;/h2*4-6,8H,1-3H3;/q-1;;+2 |
| InChIKey | KXXUPCVZVCMIDV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|