C21H21N5Pt — CID 58401365
1,5-dimethyl-4-phenylimidazole;3,5-dimethyl-1-phenyl-1,2,4-triazole;platinum(2+) (PubChem CID 58401365) has the molecular formula C21H21N5Pt and a molecular weight of 538.51 g/mol. Its IUPAC name is 1,5-dimethyl-4-phenylimidazole;3,5-dimethyl-1-phenyl-1,2,4-triazole;platinum(2+).
| Compound Name | 1,5-dimethyl-4-phenylimidazole;3,5-dimethyl-1-phenyl-1,2,4-triazole;platinum(2+) |
|---|---|
| PubChem CID | 58401365 |
| Molecular Formula | C21H21N5Pt |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 1,5-dimethyl-4-phenylimidazole;3,5-dimethyl-1-phenyl-1,2,4-triazole;platinum(2+) |
| SMILES | Cc1c(-c2[c-]cccc2)ncn1C.Cc1nc(C)n(-c2[c-]cccc2)n1.[Pt+2] |
| InChI | InChI=1S/C11H11N2.C10H10N3.Pt/c1-9-11(12-8-13(9)2)10-6-4-3-5-7-10;1-8-11-9(2)13(12-8)10-6-4-3-5-7-10;/h3-6,8H,1-2H3;3-6H,1-2H3;/q2*-1;+2 |
| InChIKey | FZFLNZBENVCNFM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|