C22H22N4Pt — CID 58401417
1,5-dimethyl-4-phenylimidazole;3,5-dimethyl-1-phenylpyrazole;platinum(2+) (PubChem CID 58401417) has the molecular formula C22H22N4Pt and a molecular weight of 537.52 g/mol. Its IUPAC name is 1,5-dimethyl-4-phenylimidazole;3,5-dimethyl-1-phenylpyrazole;platinum(2+).
| Compound Name | 1,5-dimethyl-4-phenylimidazole;3,5-dimethyl-1-phenylpyrazole;platinum(2+) |
|---|---|
| PubChem CID | 58401417 |
| Molecular Formula | C22H22N4Pt |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 1,5-dimethyl-4-phenylimidazole;3,5-dimethyl-1-phenylpyrazole;platinum(2+) |
| SMILES | Cc1c(-c2[c-]cccc2)ncn1C.Cc1cc(C)n(-c2[c-]cccc2)n1.[Pt+2] |
| InChI | InChI=1S/2C11H11N2.Pt/c1-9-11(12-8-13(9)2)10-6-4-3-5-7-10;1-9-8-10(2)13(12-9)11-6-4-3-5-7-11;/h2*3-6,8H,1-2H3;/q2*-1;+2 |
| InChIKey | VCRIDYRLGFZARL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|