C20H21N3O — CID 58406775
N-(N'-methylcarbamimidoyl)-8-(2-methylphenyl)-5,6-dihydronaphthalene-2-carboxamide (PubChem CID 58406775) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is N-(N'-methylcarbamimidoyl)-8-(2-methylphenyl)-5,6-dihydronaphthalene-2-carboxamide.
| Compound Name | N-(N'-methylcarbamimidoyl)-8-(2-methylphenyl)-5,6-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58406775 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-(N'-methylcarbamimidoyl)-8-(2-methylphenyl)-5,6-dihydronaphthalene-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1ccc2c(c1)C(c1ccccc1C)=CCC2 |
| InChI | InChI=1S/C20H21N3O/c1-13-6-3-4-8-16(13)17-9-5-7-14-10-11-15(12-18(14)17)19(24)23-20(21)22-2/h3-4,6,8-12H,5,7H2,1-2H3,(H3,21,22,23,24) |
| InChIKey | IKMSYKHYBPMTMI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|