C32H39N5O3 — CID 58412574
5-(4-hexylpiperazin-1-yl)-2-methylidene-5-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1,3-diazinane-4,6-dione (PubChem CID 58412574) has the molecular formula C32H39N5O3 and a molecular weight of 541.70 g/mol. Its IUPAC name is 5-(4-hexylpiperazin-1-yl)-2-methylidene-5-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1,3-diazinane-4,6-dione.
| Compound Name | 5-(4-hexylpiperazin-1-yl)-2-methylidene-5-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 58412574 |
| Molecular Formula | C32H39N5O3 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | 5-(4-hexylpiperazin-1-yl)-2-methylidene-5-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-1,3-diazinane-4,6-dione |
| SMILES | C=C1NC(=O)C(c2ccc(OCc3cc(C)nc4ccccc34)cc2)(N2CCN(CCCCCC)CC2)C(=O)N1 |
| InChI | InChI=1S/C32H39N5O3/c1-4-5-6-9-16-36-17-19-37(20-18-36)32(30(38)34-24(3)35-31(32)39)26-12-14-27(15-13-26)40-22-25-21-23(2)33-29-11-8-7-10-28(25)29/h7-8,10-15,21H,3-6,9,16-20,22H2,1-2H3,(H,34,38)(H,35,39) |
| InChIKey | UXIMNOUVPSTLMR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|