C11H10N2O4 — CID 58412749
N-hydroxy-2-(5-methyl-1,3-dioxoisoindol-2-yl)-2-tritioacetamide (PubChem CID 58412749) has the molecular formula C11H10N2O4 and a molecular weight of 236.22 g/mol. Its IUPAC name is N-hydroxy-2-(5-methyl-1,3-dioxoisoindol-2-yl)-2-tritioacetamide.
| Compound Name | N-hydroxy-2-(5-methyl-1,3-dioxoisoindol-2-yl)-2-tritioacetamide |
|---|---|
| PubChem CID | 58412749 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | N-hydroxy-2-(5-methyl-1,3-dioxoisoindol-2-yl)-2-tritioacetamide |
| SMILES | [3H]C(C(=O)NO)N1C(=O)c2ccc(C)cc2C1=O |
| InChI | InChI=1S/C11H10N2O4/c1-6-2-3-7-8(4-6)11(16)13(10(7)15)5-9(14)12-17/h2-4,17H,5H2,1H3,(H,12,14)/i5T |
| InChIKey | DGBPSWMBEJGRAC-XHHURNKPSA-N |
| XLogP | 0.10 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|