C26H21NO4 — CID 58412798
(2S,3R)-3-hydroxy-2-[3-oxo-6-[4-(2-phenylethynyl)phenyl]-1H-isoindol-2-yl]butanoic acid (PubChem CID 58412798) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[3-oxo-6-[4-(2-phenylethynyl)phenyl]-1H-isoindol-2-yl]butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[3-oxo-6-[4-(2-phenylethynyl)phenyl]-1H-isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 58412798 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[3-oxo-6-[4-(2-phenylethynyl)phenyl]-1H-isoindol-2-yl]butanoic acid |
| SMILES | C[C@@H](O)[C@@H](C(=O)O)N1Cc2cc(-c3ccc(C#Cc4ccccc4)cc3)ccc2C1=O |
| InChI | InChI=1S/C26H21NO4/c1-17(28)24(26(30)31)27-16-22-15-21(13-14-23(22)25(27)29)20-11-9-19(10-12-20)8-7-18-5-3-2-4-6-18/h2-6,9-15,17,24,28H,16H2,1H3,(H,30,31)/t17-,24+/m1/s1 |
| InChIKey | ZFIPYKPKWNRWMI-OSPHWJPCSA-N |
| XLogP | 3.54 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|