About phenyl(propyl)borinic acid
phenyl(propyl)borinic acid (PubChem CID 58414002) has the molecular formula C9H13BO
and a molecular weight of 148.01 g/mol. Its IUPAC name is phenyl(propyl)borinic acid.
Molecular Properties
| Compound Name | phenyl(propyl)borinic acid |
| PubChem CID | 58414002 |
| Molecular Formula | C9H13BO |
| Molecular Weight | 148.01 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | phenyl(propyl)borinic acid |
| SMILES | CCCB(O)c1ccccc1 |
| InChI | InChI=1S/C9H13BO/c1-2-8-10(11)9-6-4-3-5-7-9/h3-7,11H,2,8H2,1H3 |
| InChIKey | UILMMZUSGNPRGM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.01 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze phenyl(propyl)borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(propyl)borinic acid?
The IUPAC name of phenyl(propyl)borinic acid (CID 58414002) is phenyl(propyl)borinic acid.
What is the SMILES notation for phenyl(propyl)borinic acid?
The canonical SMILES for phenyl(propyl)borinic acid is CCCB(O)c1ccccc1.
What is the InChIKey of phenyl(propyl)borinic acid?
The InChIKey is UILMMZUSGNPRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BO/c1-2-8-10(11)9-6-4-3-5-7-9/h3-7,11H,2,8H2,1H3.
What are the key properties of phenyl(propyl)borinic acid?
phenyl(propyl)borinic acid has a molecular weight of 148.01 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(propyl)borinic acid is sourced from PubChem (CID 58414002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).