phenyl(propyl)borinic acid

C9H13BO — CID 58414002

IUPACphenyl(propyl)borinic acid
SMILESCCCB(O)c1ccccc1
InChIInChI=1S/C9H13BO/c1-2-8-10(11)9-6-4-3-5-7-9/h3-7,11H,2,8H2,1H3
InChIKeyUILMMZUSGNPRGM-UHFFFAOYSA-N
MW148.01 g/mol
LogP1.29
Rot. Bonds3

About phenyl(propyl)borinic acid

phenyl(propyl)borinic acid (PubChem CID 58414002) has the molecular formula C9H13BO and a molecular weight of 148.01 g/mol. Its IUPAC name is phenyl(propyl)borinic acid.

Molecular Properties

Compound Namephenyl(propyl)borinic acid
PubChem CID58414002
Molecular FormulaC9H13BO
Molecular Weight148.01 g/mol
Exact Mass148.11
IUPAC Namephenyl(propyl)borinic acid
SMILESCCCB(O)c1ccccc1
InChIInChI=1S/C9H13BO/c1-2-8-10(11)9-6-4-3-5-7-9/h3-7,11H,2,8H2,1H3
InChIKeyUILMMZUSGNPRGM-UHFFFAOYSA-N
XLogP1.29
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.01
LogP ≤ 51.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze phenyl(propyl)borinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phenyl(propyl)borinic acid?
The IUPAC name of phenyl(propyl)borinic acid (CID 58414002) is phenyl(propyl)borinic acid.
What is the SMILES notation for phenyl(propyl)borinic acid?
The canonical SMILES for phenyl(propyl)borinic acid is CCCB(O)c1ccccc1.
What is the InChIKey of phenyl(propyl)borinic acid?
The InChIKey is UILMMZUSGNPRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BO/c1-2-8-10(11)9-6-4-3-5-7-9/h3-7,11H,2,8H2,1H3.
What are the key properties of phenyl(propyl)borinic acid?
phenyl(propyl)borinic acid has a molecular weight of 148.01 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(propyl)borinic acid is sourced from PubChem (CID 58414002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).