C22H18F3NO3 — CID 58415896
2-[[6-(3-methoxyphenyl)-5-(trifluoromethyl)-3-pyridinyl]methyl]-5-methylbenzoic acid (PubChem CID 58415896) has the molecular formula C22H18F3NO3 and a molecular weight of 401.38 g/mol. Its IUPAC name is 2-[[6-(3-methoxyphenyl)-5-(trifluoromethyl)-3-pyridinyl]methyl]-5-methylbenzoic acid.
| Compound Name | 2-[[6-(3-methoxyphenyl)-5-(trifluoromethyl)-3-pyridinyl]methyl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 58415896 |
| Molecular Formula | C22H18F3NO3 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-[[6-(3-methoxyphenyl)-5-(trifluoromethyl)-3-pyridinyl]methyl]-5-methylbenzoic acid |
| SMILES | COc1cccc(-c2ncc(Cc3ccc(C)cc3C(=O)O)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C22H18F3NO3/c1-13-6-7-15(18(8-13)21(27)28)9-14-10-19(22(23,24)25)20(26-12-14)16-4-3-5-17(11-16)29-2/h3-8,10-12H,9H2,1-2H3,(H,27,28) |
| InChIKey | FRDWKPGIRXBLFM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |