C22H18N4O4S2 — CID 58416252
[5-[[(1S)-2-(4-nitrophenyl)-1-(2-phenyl-1,3-thiazol-4-yl)ethyl]amino]-1,3-thiazol-4-yl]methyl formate (PubChem CID 58416252) has the molecular formula C22H18N4O4S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is [5-[[(1S)-2-(4-nitrophenyl)-1-(2-phenyl-1,3-thiazol-4-yl)ethyl]amino]-1,3-thiazol-4-yl]methyl formate.
| Compound Name | [5-[[(1S)-2-(4-nitrophenyl)-1-(2-phenyl-1,3-thiazol-4-yl)ethyl]amino]-1,3-thiazol-4-yl]methyl formate |
|---|---|
| PubChem CID | 58416252 |
| Molecular Formula | C22H18N4O4S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | [5-[[(1S)-2-(4-nitrophenyl)-1-(2-phenyl-1,3-thiazol-4-yl)ethyl]amino]-1,3-thiazol-4-yl]methyl formate |
| SMILES | O=COCc1ncsc1N[C@@H](Cc1ccc([N+](=O)[O-])cc1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H18N4O4S2/c27-14-30-11-19-22(32-13-23-19)24-18(10-15-6-8-17(9-7-15)26(28)29)20-12-31-21(25-20)16-4-2-1-3-5-16/h1-9,12-14,18,24H,10-11H2/t18-/m0/s1 |
| InChIKey | JLJPRHNZYLAABR-SFHVURJKSA-N |
| XLogP | 5.24 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|