C17H24N2O3 — CID 58417487
N-hydroxy-4-[1-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]ethyl]benzamide (PubChem CID 58417487) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-hydroxy-4-[1-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]ethyl]benzamide.
| Compound Name | N-hydroxy-4-[1-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 58417487 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-hydroxy-4-[1-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]ethyl]benzamide |
| SMILES | CC(NC(=O)C1C(C)(C)C1(C)C)c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C17H24N2O3/c1-10(11-6-8-12(9-7-11)14(20)19-22)18-15(21)13-16(2,3)17(13,4)5/h6-10,13,22H,1-5H3,(H,18,21)(H,19,20) |
| InChIKey | YVZXRZRVXNSRQB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|