C20H23NO3 — CID 58417651
N-hydroxy-4-[(2S,6R)-4-oxo-6-phenylheptan-2-yl]benzamide (PubChem CID 58417651) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-hydroxy-4-[(2S,6R)-4-oxo-6-phenylheptan-2-yl]benzamide.
| Compound Name | N-hydroxy-4-[(2S,6R)-4-oxo-6-phenylheptan-2-yl]benzamide |
|---|---|
| PubChem CID | 58417651 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-hydroxy-4-[(2S,6R)-4-oxo-6-phenylheptan-2-yl]benzamide |
| SMILES | C[C@H](CC(=O)C[C@H](C)c1ccc(C(=O)NO)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO3/c1-14(16-6-4-3-5-7-16)12-19(22)13-15(2)17-8-10-18(11-9-17)20(23)21-24/h3-11,14-15,24H,12-13H2,1-2H3,(H,21,23)/t14-,15+/m1/s1 |
| InChIKey | KJCXRIHFKBHATH-CABCVRRESA-N |
| XLogP | 4.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|