C22H22N2O4 — CID 58418310
N-hydroxy-5-[(1S)-1-[(4-phenylbenzoyl)amino]butyl]furan-2-carboxamide (PubChem CID 58418310) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-hydroxy-5-[(1S)-1-[(4-phenylbenzoyl)amino]butyl]furan-2-carboxamide.
| Compound Name | N-hydroxy-5-[(1S)-1-[(4-phenylbenzoyl)amino]butyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 58418310 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-hydroxy-5-[(1S)-1-[(4-phenylbenzoyl)amino]butyl]furan-2-carboxamide |
| SMILES | CCC[C@H](NC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(C(=O)NO)o1 |
| InChI | InChI=1S/C22H22N2O4/c1-2-6-18(19-13-14-20(28-19)22(26)24-27)23-21(25)17-11-9-16(10-12-17)15-7-4-3-5-8-15/h3-5,7-14,18,27H,2,6H2,1H3,(H,23,25)(H,24,26)/t18-/m0/s1 |
| InChIKey | JDWZKIVZOPKXQP-SFHVURJKSA-N |
| XLogP | 4.34 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|