C9H14N2O3 — CID 88903392
5-[(1S)-1-aminobutyl]-N-hydroxyfuran-2-carboxamide (PubChem CID 88903392) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 5-[(1S)-1-aminobutyl]-N-hydroxyfuran-2-carboxamide.
| Compound Name | 5-[(1S)-1-aminobutyl]-N-hydroxyfuran-2-carboxamide |
|---|---|
| PubChem CID | 88903392 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 5-[(1S)-1-aminobutyl]-N-hydroxyfuran-2-carboxamide |
| SMILES | CCC[C@H](N)c1ccc(C(=O)NO)o1 |
| InChI | InChI=1S/C9H14N2O3/c1-2-3-6(10)7-4-5-8(14-7)9(12)11-13/h4-6,13H,2-3,10H2,1H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | HPVIMKVVSGYALG-LURJTMIESA-N |
| XLogP | 1.20 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|