C17H33N3O5 — CID 58419101
2-[3-[[2,2-dimethyl-3-(methylamino)-3-oxopropanoyl]amino]propyl-(2-methoxyethyl)amino]ethyl propanoate (PubChem CID 58419101) has the molecular formula C17H33N3O5 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-[3-[[2,2-dimethyl-3-(methylamino)-3-oxopropanoyl]amino]propyl-(2-methoxyethyl)amino]ethyl propanoate.
| Compound Name | 2-[3-[[2,2-dimethyl-3-(methylamino)-3-oxopropanoyl]amino]propyl-(2-methoxyethyl)amino]ethyl propanoate |
|---|---|
| PubChem CID | 58419101 |
| Molecular Formula | C17H33N3O5 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 2-[3-[[2,2-dimethyl-3-(methylamino)-3-oxopropanoyl]amino]propyl-(2-methoxyethyl)amino]ethyl propanoate |
| SMILES | CCC(=O)OCCN(CCCNC(=O)C(C)(C)C(=O)NC)CCOC |
| InChI | InChI=1S/C17H33N3O5/c1-6-14(21)25-13-11-20(10-12-24-5)9-7-8-19-16(23)17(2,3)15(22)18-4/h6-13H2,1-5H3,(H,18,22)(H,19,23) |
| InChIKey | BZGDBGBJFVHNIG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|