C28H27BIrN2O2-2 — CID 58420998
iridium;2-phenylpyridine;2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 58420998) has the molecular formula C28H27BIrN2O2-2 and a molecular weight of 626.57 g/mol. Its IUPAC name is iridium;2-phenylpyridine;2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | iridium;2-phenylpyridine;2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 58420998 |
| Molecular Formula | C28H27BIrN2O2-2 |
| Molecular Weight | 626.57 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | iridium;2-phenylpyridine;2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2ccnc(-c3[c-]cccc3)c2)OC1(C)C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C17H19BNO2.C11H8N.Ir/c1-16(2)17(3,4)21-18(20-16)14-10-11-19-15(12-14)13-8-6-5-7-9-13;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-8,10-12H,1-4H3;1-6,8-9H;/q2*-1; |
| InChIKey | JUBZLZOWKLWFCM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|