C19H30F9NO5 — CID 58421298
N-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]-2-[4,4,4-trifluoro-2,2-bis(2,2,2-trifluoroethyl)butoxy]acetamide (PubChem CID 58421298) has the molecular formula C19H30F9NO5 and a molecular weight of 523.43 g/mol. Its IUPAC name is N-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]-2-[4,4,4-trifluoro-2,2-bis(2,2,2-trifluoroethyl)butoxy]acetamide.
| Compound Name | N-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]-2-[4,4,4-trifluoro-2,2-bis(2,2,2-trifluoroethyl)butoxy]acetamide |
|---|---|
| PubChem CID | 58421298 |
| Molecular Formula | C19H30F9NO5 |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | N-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]-2-[4,4,4-trifluoro-2,2-bis(2,2,2-trifluoroethyl)butoxy]acetamide |
| SMILES | CCCOCCOCCOCCNC(=O)COCC(CC(F)(F)F)(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C19H30F9NO5/c1-2-4-31-6-8-33-9-7-32-5-3-29-15(30)10-34-14-16(11-17(20,21)22,12-18(23,24)25)13-19(26,27)28/h2-14H2,1H3,(H,29,30) |
| InChIKey | YIVXBSLLSLGBJM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|