C21H31FN6O2 — CID 58422035
5-(diaminomethylideneamino)-2-(ethylamino)-N-[1-(5-fluoro-1H-indol-3-yl)-3-oxopentan-2-yl]pentanamide (PubChem CID 58422035) has the molecular formula C21H31FN6O2 and a molecular weight of 418.52 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-(ethylamino)-N-[1-(5-fluoro-1H-indol-3-yl)-3-oxopentan-2-yl]pentanamide.
| Compound Name | 5-(diaminomethylideneamino)-2-(ethylamino)-N-[1-(5-fluoro-1H-indol-3-yl)-3-oxopentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 58422035 |
| Molecular Formula | C21H31FN6O2 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-(ethylamino)-N-[1-(5-fluoro-1H-indol-3-yl)-3-oxopentan-2-yl]pentanamide |
| SMILES | CCNC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccc(F)cc12)C(=O)CC |
| InChI | InChI=1S/C21H31FN6O2/c1-3-19(29)18(10-13-12-27-16-8-7-14(22)11-15(13)16)28-20(30)17(25-4-2)6-5-9-26-21(23)24/h7-8,11-12,17-18,25,27H,3-6,9-10H2,1-2H3,(H,28,30)(H4,23,24,26) |
| InChIKey | FXGWWNFHAIARGP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|