C11H18F3N2O7S- — CID 58422428
3-[6-(carboxyamino)hexylcarbamoyloxy]-1,1,2-trifluoropropane-1-sulfonate (PubChem CID 58422428) has the molecular formula C11H18F3N2O7S- and a molecular weight of 379.33 g/mol. Its IUPAC name is 3-[6-(carboxyamino)hexylcarbamoyloxy]-1,1,2-trifluoropropane-1-sulfonate.
| Compound Name | 3-[6-(carboxyamino)hexylcarbamoyloxy]-1,1,2-trifluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 58422428 |
| Molecular Formula | C11H18F3N2O7S- |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 3-[6-(carboxyamino)hexylcarbamoyloxy]-1,1,2-trifluoropropane-1-sulfonate |
| SMILES | O=C(O)NCCCCCCNC(=O)OCC(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C11H19F3N2O7S/c12-8(11(13,14)24(20,21)22)7-23-10(19)16-6-4-2-1-3-5-15-9(17)18/h8,15H,1-7H2,(H,16,19)(H,17,18)(H,20,21,22)/p-1 |
| InChIKey | MHIZDGTZNGZRLC-UHFFFAOYSA-M |
| XLogP | 1.02 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|