C56H106O7 — CID 58422955
[(3R,4S,6S)-3,4,5-trimethyl-6-[(2S,4S,5R)-3,4,5-trimethyl-6-(3-octylundecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-octylundecanoate (PubChem CID 58422955) has the molecular formula C56H106O7 and a molecular weight of 891.46 g/mol. Its IUPAC name is [(3R,4S,6S)-3,4,5-trimethyl-6-[(2S,4S,5R)-3,4,5-trimethyl-6-(3-octylundecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-octylundecanoate.
| Compound Name | [(3R,4S,6S)-3,4,5-trimethyl-6-[(2S,4S,5R)-3,4,5-trimethyl-6-(3-octylundecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-octylundecanoate |
|---|---|
| PubChem CID | 58422955 |
| Molecular Formula | C56H106O7 |
| Molecular Weight | 891.46 g/mol |
| Exact Mass | 890.79 |
| IUPAC Name | [(3R,4S,6S)-3,4,5-trimethyl-6-[(2S,4S,5R)-3,4,5-trimethyl-6-(3-octylundecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-octylundecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)CC(=O)OCC1O[C@@H](O[C@@H]2OC(COC(=O)CC(CCCCCCCC)CCCCCCCC)[C@H](C)[C@H](C)C2C)C(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C56H106O7/c1-11-15-19-23-27-31-35-49(36-32-28-24-20-16-12-2)39-53(57)59-41-51-45(7)43(5)47(9)55(61-51)63-56-48(10)44(6)46(8)52(62-56)42-60-54(58)40-50(37-33-29-25-21-17-13-3)38-34-30-26-22-18-14-4/h43-52,55-56H,11-42H2,1-10H3/t43-,44-,45+,46+,47?,48?,51?,52?,55-,56-/m0/s1 |
| InChIKey | KSWJDMANZLWQMF-NYNJDMANSA-N |
| XLogP | 16.37 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.46 |
| LogP ≤ 5 | 16.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|