C60H114O7 — CID 58422957
[(3R,4S,6S)-3,4,5-trimethyl-6-[(2S,4S,5R)-3,4,5-trimethyl-6-(3-nonyldodecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-nonyldodecanoate (PubChem CID 58422957) has the molecular formula C60H114O7 and a molecular weight of 947.56 g/mol. Its IUPAC name is [(3R,4S,6S)-3,4,5-trimethyl-6-[(2S,4S,5R)-3,4,5-trimethyl-6-(3-nonyldodecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-nonyldodecanoate.
| Compound Name | [(3R,4S,6S)-3,4,5-trimethyl-6-[(2S,4S,5R)-3,4,5-trimethyl-6-(3-nonyldodecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-nonyldodecanoate |
|---|---|
| PubChem CID | 58422957 |
| Molecular Formula | C60H114O7 |
| Molecular Weight | 947.56 g/mol |
| Exact Mass | 946.86 |
| IUPAC Name | [(3R,4S,6S)-3,4,5-trimethyl-6-[(2S,4S,5R)-3,4,5-trimethyl-6-(3-nonyldodecanoyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl 3-nonyldodecanoate |
| SMILES | CCCCCCCCCC(CCCCCCCCC)CC(=O)OCC1O[C@@H](O[C@@H]2OC(COC(=O)CC(CCCCCCCCC)CCCCCCCCC)[C@H](C)[C@H](C)C2C)C(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C60H114O7/c1-11-15-19-23-27-31-35-39-53(40-36-32-28-24-20-16-12-2)43-57(61)63-45-55-49(7)47(5)51(9)59(65-55)67-60-52(10)48(6)50(8)56(66-60)46-64-58(62)44-54(41-37-33-29-25-21-17-13-3)42-38-34-30-26-22-18-14-4/h47-56,59-60H,11-46H2,1-10H3/t47-,48-,49+,50+,51?,52?,55?,56?,59-,60-/m0/s1 |
| InChIKey | GTFJTMRWTFYJKT-KAXINUFSSA-N |
| XLogP | 17.93 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.56 |
| LogP ≤ 5 | 17.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|