C18H15BrO3 — CID 58423914
6-bromo-2-(3,4-dihydro-2H-chromen-4-yl)-2,3-dihydrochromen-4-one (PubChem CID 58423914) has the molecular formula C18H15BrO3 and a molecular weight of 359.22 g/mol. Its IUPAC name is 6-bromo-2-(3,4-dihydro-2H-chromen-4-yl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-bromo-2-(3,4-dihydro-2H-chromen-4-yl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 58423914 |
| Molecular Formula | C18H15BrO3 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 6-bromo-2-(3,4-dihydro-2H-chromen-4-yl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(C2CCOc3ccccc32)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C18H15BrO3/c19-11-5-6-17-14(9-11)15(20)10-18(22-17)13-7-8-21-16-4-2-1-3-12(13)16/h1-6,9,13,18H,7-8,10H2 |
| InChIKey | SRTDPFXAPIADJP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |