C16H15F5IrN3- — CID 58426439
4-cyclohexyl-3-(1,1,2,2,2-pentafluoroethyl)-5-phenyl-1,2,4-triazole;iridium (PubChem CID 58426439) has the molecular formula C16H15F5IrN3- and a molecular weight of 536.52 g/mol. Its IUPAC name is 4-cyclohexyl-3-(1,1,2,2,2-pentafluoroethyl)-5-phenyl-1,2,4-triazole;iridium.
| Compound Name | 4-cyclohexyl-3-(1,1,2,2,2-pentafluoroethyl)-5-phenyl-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 58426439 |
| Molecular Formula | C16H15F5IrN3- |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | 4-cyclohexyl-3-(1,1,2,2,2-pentafluoroethyl)-5-phenyl-1,2,4-triazole;iridium |
| SMILES | FC(F)(F)C(F)(F)c1nnc(-c2[c-]cccc2)n1C1CCCCC1.[Ir] |
| InChI | InChI=1S/C16H15F5N3.Ir/c17-15(18,16(19,20)21)14-23-22-13(11-7-3-1-4-8-11)24(14)12-9-5-2-6-10-12;/h1,3-4,7,12H,2,5-6,9-10H2;/q-1; |
| InChIKey | TVGNKRCVWYKPHR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|