C15H18IrN3- — CID 140777405
1-cyclohexyl-3-methyl-5-(2,3,4,5-tetradeuteriobenzene-6-id-1-yl)-1,2,4-triazole;iridium (PubChem CID 140777405) has the molecular formula C15H18IrN3- and a molecular weight of 436.57 g/mol. Its IUPAC name is 1-cyclohexyl-3-methyl-5-(2,3,4,5-tetradeuteriobenzene-6-id-1-yl)-1,2,4-triazole;iridium.
| Compound Name | 1-cyclohexyl-3-methyl-5-(2,3,4,5-tetradeuteriobenzene-6-id-1-yl)-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 140777405 |
| Molecular Formula | C15H18IrN3- |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 1-cyclohexyl-3-methyl-5-(2,3,4,5-tetradeuteriobenzene-6-id-1-yl)-1,2,4-triazole;iridium |
| SMILES | [2H]c1[c-]c(-c2nc(C)nn2C2CCCCC2)c([2H])c([2H])c1[2H].[Ir] |
| InChI | InChI=1S/C15H18N3.Ir/c1-12-16-15(13-8-4-2-5-9-13)18(17-12)14-10-6-3-7-11-14;/h2,4-5,8,14H,3,6-7,10-11H2,1H3;/q-1;/i2D,4D,5D,8D; |
| InChIKey | KDFZRTXKTBQXCF-GFSAPRAJSA-N |
| XLogP | 3.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|