C11H11BrFN3 — CID 142515029
2-bromo-7-fluoro-5-[(3E)-hexa-1,3,5-trien-3-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 142515029) has the molecular formula C11H11BrFN3 and a molecular weight of 284.13 g/mol. Its IUPAC name is 2-bromo-7-fluoro-5-[(3E)-hexa-1,3,5-trien-3-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | 2-bromo-7-fluoro-5-[(3E)-hexa-1,3,5-trien-3-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 142515029 |
| Molecular Formula | C11H11BrFN3 |
| Molecular Weight | 284.13 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 2-bromo-7-fluoro-5-[(3E)-hexa-1,3,5-trien-3-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C=C/C=C(\C=C)C1CC(F)c2nc(Br)nn21 |
| InChI | InChI=1S/C11H11BrFN3/c1-3-5-7(4-2)9-6-8(13)10-14-11(12)15-16(9)10/h3-5,8-9H,1-2,6H2/b7-5+ |
| InChIKey | VXPIZPORFAVXCS-FNORWQNLSA-N |
| XLogP | 3.29 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.13 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|