C14H18FN3S — CID 142577369
2-ethylsulfanyl-5-[(3Z,5E)-5-fluorohepta-1,3,5-trien-4-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 142577369) has the molecular formula C14H18FN3S and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-ethylsulfanyl-5-[(3Z,5E)-5-fluorohepta-1,3,5-trien-4-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | 2-ethylsulfanyl-5-[(3Z,5E)-5-fluorohepta-1,3,5-trien-4-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 142577369 |
| Molecular Formula | C14H18FN3S |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-ethylsulfanyl-5-[(3Z,5E)-5-fluorohepta-1,3,5-trien-4-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C=C/C=C(C(\F)=C/C)/C1CCc2nc(SCC)nn21 |
| InChI | InChI=1S/C14H18FN3S/c1-4-7-10(11(15)5-2)12-8-9-13-16-14(19-6-3)17-18(12)13/h4-5,7,12H,1,6,8-9H2,2-3H3/b10-7+,11-5+ |
| InChIKey | HAQGOKSRPYNPJR-OLZFMVIBSA-N |
| XLogP | 3.86 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|