C12H12IrN3- — CID 140603852
iridium;3-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 140603852) has the molecular formula C12H12IrN3- and a molecular weight of 390.47 g/mol. Its IUPAC name is iridium;3-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | iridium;3-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 140603852 |
| Molecular Formula | C12H12IrN3- |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | iridium;3-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | [Ir].[c-]1ccccc1-c1nnc2n1CCCC2 |
| InChI | InChI=1S/C12H12N3.Ir/c1-2-6-10(7-3-1)12-14-13-11-8-4-5-9-15(11)12;/h1-3,6H,4-5,8-9H2;/q-1; |
| InChIKey | LEMQUUKPOWHQJZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|