C16H14N4S — CID 58427763
6-[(3-aminophenyl)methylamino]-4-methyl-1,3-benzothiazole-2-carbonitrile (PubChem CID 58427763) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 6-[(3-aminophenyl)methylamino]-4-methyl-1,3-benzothiazole-2-carbonitrile.
| Compound Name | 6-[(3-aminophenyl)methylamino]-4-methyl-1,3-benzothiazole-2-carbonitrile |
|---|---|
| PubChem CID | 58427763 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 6-[(3-aminophenyl)methylamino]-4-methyl-1,3-benzothiazole-2-carbonitrile |
| SMILES | Cc1cc(NCc2cccc(N)c2)cc2sc(C#N)nc12 |
| InChI | InChI=1S/C16H14N4S/c1-10-5-13(7-14-16(10)20-15(8-17)21-14)19-9-11-3-2-4-12(18)6-11/h2-7,19H,9,18H2,1H3 |
| InChIKey | ILAMRJKIZNTFQN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|