C15H12N4S — CID 58427736
6-[(3-aminophenyl)methylamino]-1,3-benzothiazole-2-carbonitrile (PubChem CID 58427736) has the molecular formula C15H12N4S and a molecular weight of 280.36 g/mol. Its IUPAC name is 6-[(3-aminophenyl)methylamino]-1,3-benzothiazole-2-carbonitrile.
| Compound Name | 6-[(3-aminophenyl)methylamino]-1,3-benzothiazole-2-carbonitrile |
|---|---|
| PubChem CID | 58427736 |
| Molecular Formula | C15H12N4S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 6-[(3-aminophenyl)methylamino]-1,3-benzothiazole-2-carbonitrile |
| SMILES | N#Cc1nc2ccc(NCc3cccc(N)c3)cc2s1 |
| InChI | InChI=1S/C15H12N4S/c16-8-15-19-13-5-4-12(7-14(13)20-15)18-9-10-2-1-3-11(17)6-10/h1-7,18H,9,17H2 |
| InChIKey | LEWXUYWINQXPJB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|