C27H24F3N5O5 — CID 58429107
5-[2-[2-(3-methylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]-2-oxoethyl]-N-(2-nitrophenyl)indole-1-carboxamide (PubChem CID 58429107) has the molecular formula C27H24F3N5O5 and a molecular weight of 555.51 g/mol. Its IUPAC name is 5-[2-[2-(3-methylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]-2-oxoethyl]-N-(2-nitrophenyl)indole-1-carboxamide.
| Compound Name | 5-[2-[2-(3-methylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]-2-oxoethyl]-N-(2-nitrophenyl)indole-1-carboxamide |
|---|---|
| PubChem CID | 58429107 |
| Molecular Formula | C27H24F3N5O5 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | 5-[2-[2-(3-methylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]-2-oxoethyl]-N-(2-nitrophenyl)indole-1-carboxamide |
| SMILES | CC1CCCN(c2nc(C(F)(F)F)c(C(=O)Cc3ccc4c(ccn4C(=O)Nc4ccccc4[N+](=O)[O-])c3)o2)C1 |
| InChI | InChI=1S/C27H24F3N5O5/c1-16-5-4-11-33(15-16)26-32-24(27(28,29)30)23(40-26)22(36)14-17-8-9-20-18(13-17)10-12-34(20)25(37)31-19-6-2-3-7-21(19)35(38)39/h2-3,6-10,12-13,16H,4-5,11,14-15H2,1H3,(H,31,37) |
| InChIKey | HODMHSKVMOQMPX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|