C11H18N2O2 — CID 58431143
3-[(3R)-1-propan-2-ylpiperidin-3-yl]-4H-1,2-oxazol-5-one (PubChem CID 58431143) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-[(3R)-1-propan-2-ylpiperidin-3-yl]-4H-1,2-oxazol-5-one.
| Compound Name | 3-[(3R)-1-propan-2-ylpiperidin-3-yl]-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 58431143 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-[(3R)-1-propan-2-ylpiperidin-3-yl]-4H-1,2-oxazol-5-one |
| SMILES | CC(C)N1CCC[C@@H](C2=NOC(=O)C2)C1 |
| InChI | InChI=1S/C11H18N2O2/c1-8(2)13-5-3-4-9(7-13)10-6-11(14)15-12-10/h8-9H,3-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | BQDCSQQJMDLJDI-SECBINFHSA-N |
| XLogP | 1.41 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|