C22H20N2O2S2 — CID 58432416
(5Z)-3-(4-oxo-5-pyridin-2-ylpentyl)-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 58432416) has the molecular formula C22H20N2O2S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (5Z)-3-(4-oxo-5-pyridin-2-ylpentyl)-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(4-oxo-5-pyridin-2-ylpentyl)-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58432416 |
| Molecular Formula | C22H20N2O2S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (5Z)-3-(4-oxo-5-pyridin-2-ylpentyl)-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C(CCCN1C(=O)/C(=C/C=C/c2ccccc2)SC1=S)Cc1ccccn1 |
| InChI | InChI=1S/C22H20N2O2S2/c25-19(16-18-11-4-5-14-23-18)12-7-15-24-21(26)20(28-22(24)27)13-6-10-17-8-2-1-3-9-17/h1-6,8-11,13-14H,7,12,15-16H2/b10-6+,20-13- |
| InChIKey | BNAJHPMWYWXEAY-OJZYNGEUSA-N |
| XLogP | 4.43 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|