C21H20Cl2N2O3 — CID 58433633
(2R,3R)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-N-[2-(4-chlorophenyl)-2-oxoethyl]-3-hydroxybutanamide (PubChem CID 58433633) has the molecular formula C21H20Cl2N2O3 and a molecular weight of 419.31 g/mol. Its IUPAC name is (2R,3R)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-N-[2-(4-chlorophenyl)-2-oxoethyl]-3-hydroxybutanamide.
| Compound Name | (2R,3R)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-N-[2-(4-chlorophenyl)-2-oxoethyl]-3-hydroxybutanamide |
|---|---|
| PubChem CID | 58433633 |
| Molecular Formula | C21H20Cl2N2O3 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (2R,3R)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-N-[2-(4-chlorophenyl)-2-oxoethyl]-3-hydroxybutanamide |
| SMILES | [C-]#[N+]c1ccc(C[C@@H](C(=O)NCC(=O)c2ccc(Cl)cc2)[C@@H](C)O)c(C)c1Cl |
| InChI | InChI=1S/C21H20Cl2N2O3/c1-12-15(6-9-18(24-3)20(12)23)10-17(13(2)26)21(28)25-11-19(27)14-4-7-16(22)8-5-14/h4-9,13,17,26H,10-11H2,1-2H3,(H,25,28)/t13-,17-/m1/s1 |
| InChIKey | VFSBYCVMANGQBO-CXAGYDPISA-N |
| XLogP | 4.39 |
| TPSA | 70.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|