C20H19ClN2O3 — CID 58433677
(2R,3S)-2-[(3-chloro-4-isocyanophenyl)methyl]-3-hydroxy-N-phenacylbutanamide (PubChem CID 58433677) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is (2R,3S)-2-[(3-chloro-4-isocyanophenyl)methyl]-3-hydroxy-N-phenacylbutanamide.
| Compound Name | (2R,3S)-2-[(3-chloro-4-isocyanophenyl)methyl]-3-hydroxy-N-phenacylbutanamide |
|---|---|
| PubChem CID | 58433677 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (2R,3S)-2-[(3-chloro-4-isocyanophenyl)methyl]-3-hydroxy-N-phenacylbutanamide |
| SMILES | [C-]#[N+]c1ccc(C[C@@H](C(=O)NCC(=O)c2ccccc2)[C@H](C)O)cc1Cl |
| InChI | InChI=1S/C20H19ClN2O3/c1-13(24)16(10-14-8-9-18(22-2)17(21)11-14)20(26)23-12-19(25)15-6-4-3-5-7-15/h3-9,11,13,16,24H,10,12H2,1H3,(H,23,26)/t13-,16+/m0/s1 |
| InChIKey | SFAKBDPUOOTXIR-XJKSGUPXSA-N |
| XLogP | 3.43 |
| TPSA | 70.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|