C11H11Cl2NO2 — CID 125485524
(2S)-2-chloro-N-[2-(4-chlorophenyl)-2-oxoethyl]propanamide (PubChem CID 125485524) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is (2S)-2-chloro-N-[2-(4-chlorophenyl)-2-oxoethyl]propanamide.
| Compound Name | (2S)-2-chloro-N-[2-(4-chlorophenyl)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 125485524 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | (2S)-2-chloro-N-[2-(4-chlorophenyl)-2-oxoethyl]propanamide |
| SMILES | C[C@H](Cl)C(=O)NCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11Cl2NO2/c1-7(12)11(16)14-6-10(15)8-2-4-9(13)5-3-8/h2-5,7H,6H2,1H3,(H,14,16)/t7-/m0/s1 |
| InChIKey | YBFYIUODODMGJK-ZETCQYMHSA-N |
| XLogP | 2.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|