C19H22N2O4 — CID 70863313
(2S)-2-[[hydroxy(phenylmethoxy)methyl]amino]-N-phenacylpropanamide (PubChem CID 70863313) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is (2S)-2-[[hydroxy(phenylmethoxy)methyl]amino]-N-phenacylpropanamide.
| Compound Name | (2S)-2-[[hydroxy(phenylmethoxy)methyl]amino]-N-phenacylpropanamide |
|---|---|
| PubChem CID | 70863313 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2S)-2-[[hydroxy(phenylmethoxy)methyl]amino]-N-phenacylpropanamide |
| SMILES | C[C@H](NC(O)OCc1ccccc1)C(=O)NCC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O4/c1-14(21-19(24)25-13-15-8-4-2-5-9-15)18(23)20-12-17(22)16-10-6-3-7-11-16/h2-11,14,19,21,24H,12-13H2,1H3,(H,20,23)/t14-,19?/m0/s1 |
| InChIKey | SYFMNYPROUZWGQ-KTQQKIMGSA-N |
| XLogP | 1.46 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|