C29H33N5O3S — CID 58441392
2-[6-[1-[(E)-7-cyclopropyl-5-oxohept-6-enyl]pyrazol-4-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one (PubChem CID 58441392) has the molecular formula C29H33N5O3S and a molecular weight of 531.68 g/mol. Its IUPAC name is 2-[6-[1-[(E)-7-cyclopropyl-5-oxohept-6-enyl]pyrazol-4-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one.
| Compound Name | 2-[6-[1-[(E)-7-cyclopropyl-5-oxohept-6-enyl]pyrazol-4-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 58441392 |
| Molecular Formula | C29H33N5O3S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 2-[6-[1-[(E)-7-cyclopropyl-5-oxohept-6-enyl]pyrazol-4-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
| SMILES | CC1(C)Cc2nc(N3CCOc4ccc(-c5cnn(CCCCC(=O)/C=C/C6CC6)c5)cc43)sc2C(=O)N1 |
| InChI | InChI=1S/C29H33N5O3S/c1-29(2)16-23-26(27(36)32-29)38-28(31-23)34-13-14-37-25-11-9-20(15-24(25)34)21-17-30-33(18-21)12-4-3-5-22(35)10-8-19-6-7-19/h8-11,15,17-19H,3-7,12-14,16H2,1-2H3,(H,32,36)/b10-8+ |
| InChIKey | BJKMCDBXVHCJOY-CSKARUKUSA-N |
| XLogP | 5.31 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|