C6H8N2O2 — CID 58443618
1-propan-2-ylimidazole-4,5-dione (PubChem CID 58443618) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is 1-propan-2-ylimidazole-4,5-dione.
| Compound Name | 1-propan-2-ylimidazole-4,5-dione |
|---|---|
| PubChem CID | 58443618 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1-propan-2-ylimidazole-4,5-dione |
| SMILES | CC(C)N1C=NC(=O)C1=O |
| InChI | InChI=1S/C6H8N2O2/c1-4(2)8-3-7-5(9)6(8)10/h3-4H,1-2H3 |
| InChIKey | KSCLLHRTYNJQSR-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|