C26H47NO12 — CID 58444867
[5-[[4-[[bis(2-hydroxyethyl)amino]methoxy]-3-hydroxybutoxy]methyl]-2-hydroxy-6-(3-hydroxy-4-prop-2-enoyloxybutoxy)hexyl] prop-2-enoate (PubChem CID 58444867) has the molecular formula C26H47NO12 and a molecular weight of 565.66 g/mol. Its IUPAC name is [5-[[4-[[bis(2-hydroxyethyl)amino]methoxy]-3-hydroxybutoxy]methyl]-2-hydroxy-6-(3-hydroxy-4-prop-2-enoyloxybutoxy)hexyl] prop-2-enoate.
| Compound Name | [5-[[4-[[bis(2-hydroxyethyl)amino]methoxy]-3-hydroxybutoxy]methyl]-2-hydroxy-6-(3-hydroxy-4-prop-2-enoyloxybutoxy)hexyl] prop-2-enoate |
|---|---|
| PubChem CID | 58444867 |
| Molecular Formula | C26H47NO12 |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | [5-[[4-[[bis(2-hydroxyethyl)amino]methoxy]-3-hydroxybutoxy]methyl]-2-hydroxy-6-(3-hydroxy-4-prop-2-enoyloxybutoxy)hexyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)CCOCC(CCC(O)COC(=O)C=C)COCCC(O)COCN(CCO)CCO |
| InChI | InChI=1S/C26H47NO12/c1-3-25(33)38-18-22(30)6-5-21(16-36-14-8-24(32)19-39-26(34)4-2)15-35-13-7-23(31)17-37-20-27(9-11-28)10-12-29/h3-4,21-24,28-32H,1-2,5-20H2 |
| InChIKey | OIQMWXSLUSHKRD-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|