C27H45NO12 — CID 91325660
[4-[2-[bis[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl]amino]ethoxy]-3-hydroxybutyl] prop-2-enoate (PubChem CID 91325660) has the molecular formula C27H45NO12 and a molecular weight of 575.65 g/mol. Its IUPAC name is [4-[2-[bis[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl]amino]ethoxy]-3-hydroxybutyl] prop-2-enoate.
| Compound Name | [4-[2-[bis[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl]amino]ethoxy]-3-hydroxybutyl] prop-2-enoate |
|---|---|
| PubChem CID | 91325660 |
| Molecular Formula | C27H45NO12 |
| Molecular Weight | 575.65 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | [4-[2-[bis[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl]amino]ethoxy]-3-hydroxybutyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOCCN(CCOCCOCCOC(=O)C=C)CCOCC(O)CCOC(=O)C=C |
| InChI | InChI=1S/C27H45NO12/c1-4-25(30)38-11-7-24(29)23-37-14-10-28(8-12-33-15-17-35-19-21-39-26(31)5-2)9-13-34-16-18-36-20-22-40-27(32)6-3/h4-6,24,29H,1-3,7-23H2 |
| InChIKey | MDANSOORUUPUDX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.65 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|