About butan-2-ylazanide;trichloroplatinum;nitrite
butan-2-ylazanide;trichloroplatinum;nitrite (PubChem CID 58445435) has the molecular formula C4H9Cl3N2O2Pt-3
and a molecular weight of 418.57 g/mol. Its IUPAC name is butan-2-ylazanide;trichloroplatinum;nitrite.
Molecular Properties
| Compound Name | butan-2-ylazanide;trichloroplatinum;nitrite |
| PubChem CID | 58445435 |
| Molecular Formula | C4H9Cl3N2O2Pt-3 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 416.94 |
| IUPAC Name | butan-2-ylazanide;trichloroplatinum;nitrite |
| SMILES | Cl[Pt](Cl)Cl.O=N[O-].[CH2-]CC(C)[NH-] |
| InChI | InChI=1S/C4H9N.3ClH.HNO2.Pt/c1-3-4(2)5;;;;2-1-3;/h4-5H,1,3H2,2H3;3*1H;(H,2,3);/q-2;;;;;+3/p-4 |
| InChIKey | USGCANIUAZDPAO-UHFFFAOYSA-J |
| XLogP | 3.97 |
| TPSA | 76.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ylazanide;trichloroplatinum;nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylazanide;trichloroplatinum;nitrite?
The IUPAC name of butan-2-ylazanide;trichloroplatinum;nitrite (CID 58445435) is butan-2-ylazanide;trichloroplatinum;nitrite.
What is the SMILES notation for butan-2-ylazanide;trichloroplatinum;nitrite?
The canonical SMILES for butan-2-ylazanide;trichloroplatinum;nitrite is Cl[Pt](Cl)Cl.O=N[O-].[CH2-]CC(C)[NH-].
What is the InChIKey of butan-2-ylazanide;trichloroplatinum;nitrite?
The InChIKey is USGCANIUAZDPAO-UHFFFAOYSA-J. The full InChI is InChI=1S/C4H9N.3ClH.HNO2.Pt/c1-3-4(2)5;;;;2-1-3;/h4-5H,1,3H2,2H3;3*1H;(H,2,3);/q-2;;;;;+3/p-4.
What are the key properties of butan-2-ylazanide;trichloroplatinum;nitrite?
butan-2-ylazanide;trichloroplatinum;nitrite has a molecular weight of 418.57 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylazanide;trichloroplatinum;nitrite is sourced from PubChem (CID 58445435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).