About 2-hydroxybutylazanide;trichloroplatinum;nitrite
2-hydroxybutylazanide;trichloroplatinum;nitrite (PubChem CID 58445433) has the molecular formula C4H9Cl3N2O3Pt-3
and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-hydroxybutylazanide;trichloroplatinum;nitrite.
Molecular Properties
| Compound Name | 2-hydroxybutylazanide;trichloroplatinum;nitrite |
| PubChem CID | 58445433 |
| Molecular Formula | C4H9Cl3N2O3Pt-3 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 432.93 |
| IUPAC Name | 2-hydroxybutylazanide;trichloroplatinum;nitrite |
| SMILES | Cl[Pt](Cl)Cl.O=N[O-].[CH2-]CC(O)C[NH-] |
| InChI | InChI=1S/C4H9NO.3ClH.HNO2.Pt/c1-2-4(6)3-5;;;;2-1-3;/h4-6H,1-3H2;3*1H;(H,2,3);/q-2;;;;;+3/p-4 |
| InChIKey | BDHZLIALRIOFKO-UHFFFAOYSA-J |
| XLogP | 2.94 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybutylazanide;trichloroplatinum;nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutylazanide;trichloroplatinum;nitrite?
The IUPAC name of 2-hydroxybutylazanide;trichloroplatinum;nitrite (CID 58445433) is 2-hydroxybutylazanide;trichloroplatinum;nitrite.
What is the SMILES notation for 2-hydroxybutylazanide;trichloroplatinum;nitrite?
The canonical SMILES for 2-hydroxybutylazanide;trichloroplatinum;nitrite is Cl[Pt](Cl)Cl.O=N[O-].[CH2-]CC(O)C[NH-].
What is the InChIKey of 2-hydroxybutylazanide;trichloroplatinum;nitrite?
The InChIKey is BDHZLIALRIOFKO-UHFFFAOYSA-J. The full InChI is InChI=1S/C4H9NO.3ClH.HNO2.Pt/c1-2-4(6)3-5;;;;2-1-3;/h4-6H,1-3H2;3*1H;(H,2,3);/q-2;;;;;+3/p-4.
What are the key properties of 2-hydroxybutylazanide;trichloroplatinum;nitrite?
2-hydroxybutylazanide;trichloroplatinum;nitrite has a molecular weight of 434.56 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutylazanide;trichloroplatinum;nitrite is sourced from PubChem (CID 58445433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).