C6H14Cl3N3O2Pt- — CID 87462705
trans-(1R,2R)-cyclohexane-1,2-diamine;trichloroplatinum;nitrite (PubChem CID 87462705) has the molecular formula C6H14Cl3N3O2Pt- and a molecular weight of 461.63 g/mol. Its IUPAC name is trans-(1R,2R)-cyclohexane-1,2-diamine;trichloroplatinum;nitrite.
| Compound Name | trans-(1R,2R)-cyclohexane-1,2-diamine;trichloroplatinum;nitrite |
|---|---|
| PubChem CID | 87462705 |
| Molecular Formula | C6H14Cl3N3O2Pt- |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | trans-(1R,2R)-cyclohexane-1,2-diamine;trichloroplatinum;nitrite |
| SMILES | Cl[Pt](Cl)Cl.N[C@@H]1CCCC[C@H]1N.O=N[O-] |
| InChI | InChI=1S/C6H14N2.3ClH.HNO2.Pt/c7-5-3-1-2-4-6(5)8;;;;2-1-3;/h5-6H,1-4,7-8H2;3*1H;(H,2,3);/q;;;;;+3/p-4/t5-,6-;;;;;/m1...../s1 |
| InChIKey | CSLJEHBYODFOEP-RQDPQJJXSA-J |
| XLogP | 2.53 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|