C27H30N2O4 — CID 58445785
N-[4-[2-(4-butylphenoxy)propanoylamino]-2-hydroxy-5-methylphenyl]benzamide (PubChem CID 58445785) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[4-[2-(4-butylphenoxy)propanoylamino]-2-hydroxy-5-methylphenyl]benzamide.
| Compound Name | N-[4-[2-(4-butylphenoxy)propanoylamino]-2-hydroxy-5-methylphenyl]benzamide |
|---|---|
| PubChem CID | 58445785 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[4-[2-(4-butylphenoxy)propanoylamino]-2-hydroxy-5-methylphenyl]benzamide |
| SMILES | CCCCc1ccc(OC(C)C(=O)Nc2cc(O)c(NC(=O)c3ccccc3)cc2C)cc1 |
| InChI | InChI=1S/C27H30N2O4/c1-4-5-9-20-12-14-22(15-13-20)33-19(3)26(31)28-23-17-25(30)24(16-18(23)2)29-27(32)21-10-7-6-8-11-21/h6-8,10-17,19,30H,4-5,9H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | KXESHMFFVSUEBY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|