C18H22NO13P3 — CID 58446603
[4-[(E)-3-[2-(3,4-diphosphonooxyphenyl)ethylamino]-3-oxoprop-1-enyl]-2-methylphenyl] dihydrogen phosphate (PubChem CID 58446603) has the molecular formula C18H22NO13P3 and a molecular weight of 553.29 g/mol. Its IUPAC name is [4-[(E)-3-[2-(3,4-diphosphonooxyphenyl)ethylamino]-3-oxoprop-1-enyl]-2-methylphenyl] dihydrogen phosphate.
| Compound Name | [4-[(E)-3-[2-(3,4-diphosphonooxyphenyl)ethylamino]-3-oxoprop-1-enyl]-2-methylphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58446603 |
| Molecular Formula | C18H22NO13P3 |
| Molecular Weight | 553.29 g/mol |
| Exact Mass | 553.03 |
| IUPAC Name | [4-[(E)-3-[2-(3,4-diphosphonooxyphenyl)ethylamino]-3-oxoprop-1-enyl]-2-methylphenyl] dihydrogen phosphate |
| SMILES | Cc1cc(/C=C/C(=O)NCCc2ccc(OP(=O)(O)O)c(OP(=O)(O)O)c2)ccc1OP(=O)(O)O |
| InChI | InChI=1S/C18H22NO13P3/c1-12-10-13(2-5-15(12)30-33(21,22)23)4-7-18(20)19-9-8-14-3-6-16(31-34(24,25)26)17(11-14)32-35(27,28)29/h2-7,10-11H,8-9H2,1H3,(H,19,20)(H2,21,22,23)(H2,24,25,26)(H2,27,28,29)/b7-4+ |
| InChIKey | UVLBGSYMYGYEPK-QPJJXVBHSA-N |
| XLogP | 1.78 |
| TPSA | 229.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|