C18H18N4O2 — CID 58448491
2-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-1-(5-methylfuran-2-yl)ethanone (PubChem CID 58448491) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-1-(5-methylfuran-2-yl)ethanone.
| Compound Name | 2-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-1-(5-methylfuran-2-yl)ethanone |
|---|---|
| PubChem CID | 58448491 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-1-(5-methylfuran-2-yl)ethanone |
| SMILES | Cc1ccc(C(=O)Cc2ccnc(CNc3cccnc3N)c2)o1 |
| InChI | InChI=1S/C18H18N4O2/c1-12-4-5-17(24-12)16(23)10-13-6-8-20-14(9-13)11-22-15-3-2-7-21-18(15)19/h2-9,22H,10-11H2,1H3,(H2,19,21) |
| InChIKey | VKELTOVEIMSMTO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |