C18H17N7O — CID 58448818
2-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-1-(3-isocyano-1-methylpyrazol-5-yl)ethanone (PubChem CID 58448818) has the molecular formula C18H17N7O and a molecular weight of 347.38 g/mol. Its IUPAC name is 2-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-1-(3-isocyano-1-methylpyrazol-5-yl)ethanone.
| Compound Name | 2-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-1-(3-isocyano-1-methylpyrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 58448818 |
| Molecular Formula | C18H17N7O |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[2-[[(2-amino-3-pyridinyl)amino]methyl]-4-pyridinyl]-1-(3-isocyano-1-methylpyrazol-5-yl)ethanone |
| SMILES | [C-]#[N+]c1cc(C(=O)Cc2ccnc(CNc3cccnc3N)c2)n(C)n1 |
| InChI | InChI=1S/C18H17N7O/c1-20-17-10-15(25(2)24-17)16(26)9-12-5-7-21-13(8-12)11-23-14-4-3-6-22-18(14)19/h3-8,10,23H,9,11H2,2H3,(H2,19,22) |
| InChIKey | DZVYEMIRBDGIRA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|