C23H27ClN6O3 — CID 58450142
3-methoxypropyl 4-[2-[(2-chlorophenyl)methylamino]pyrido[4,3-d]pyrimidin-5-yl]piperazine-1-carboxylate (PubChem CID 58450142) has the molecular formula C23H27ClN6O3 and a molecular weight of 470.96 g/mol. Its IUPAC name is 3-methoxypropyl 4-[2-[(2-chlorophenyl)methylamino]pyrido[4,3-d]pyrimidin-5-yl]piperazine-1-carboxylate.
| Compound Name | 3-methoxypropyl 4-[2-[(2-chlorophenyl)methylamino]pyrido[4,3-d]pyrimidin-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58450142 |
| Molecular Formula | C23H27ClN6O3 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 3-methoxypropyl 4-[2-[(2-chlorophenyl)methylamino]pyrido[4,3-d]pyrimidin-5-yl]piperazine-1-carboxylate |
| SMILES | COCCCOC(=O)N1CCN(c2nccc3nc(NCc4ccccc4Cl)ncc23)CC1 |
| InChI | InChI=1S/C23H27ClN6O3/c1-32-13-4-14-33-23(31)30-11-9-29(10-12-30)21-18-16-27-22(28-20(18)7-8-25-21)26-15-17-5-2-3-6-19(17)24/h2-3,5-8,16H,4,9-15H2,1H3,(H,26,27,28) |
| InChIKey | SMZRYCQNBIHLEH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|